C28H26F2N4O4 — CID 168943007
2-[2-cyclopropyloxy-3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]-6-methylpyridine-3-carboxamide (PubChem CID 168943007) has the molecular formula C28H26F2N4O4 and a molecular weight of 520.54 g/mol. Its IUPAC name is 2-[2-cyclopropyloxy-3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 2-[2-cyclopropyloxy-3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 168943007 |
| Molecular Formula | C28H26F2N4O4 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 2-[2-cyclopropyloxy-3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]-6-methylpyridine-3-carboxamide |
| SMILES | CNCCOc1ccc2c(Oc3c(F)cc(-c4nc(C)ccc4C(N)=O)c(OC4CC4)c3F)ccnc2c1 |
| InChI | InChI=1S/C28H26F2N4O4/c1-15-3-7-19(28(31)35)25(34-15)20-14-21(29)27(24(30)26(20)37-16-4-5-16)38-23-9-10-33-22-13-17(6-8-18(22)23)36-12-11-32-2/h3,6-10,13-14,16,32H,4-5,11-12H2,1-2H3,(H2,31,35) |
| InChIKey | LZYBIYBOHZQWAC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|