C26H28N4O4P2 — CID 170005576
4-ethoxy-N-[4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]pyridine-3-carboxamide (PubChem CID 170005576) has the molecular formula C26H28N4O4P2 and a molecular weight of 522.48 g/mol. Its IUPAC name is 4-ethoxy-N-[4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 4-ethoxy-N-[4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170005576 |
| Molecular Formula | C26H28N4O4P2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 4-ethoxy-N-[4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]pyridine-3-carboxamide |
| SMILES | CCOc1ccncc1C(=O)Nc1cc(P)c(Oc2ccnc3cc(OCCNC)ccc23)c(P)c1 |
| InChI | InChI=1S/C26H28N4O4P2/c1-3-32-21-6-8-28-15-19(21)26(31)30-16-12-23(35)25(24(36)13-16)34-22-7-9-29-20-14-17(4-5-18(20)22)33-11-10-27-2/h4-9,12-15,27H,3,10-11,35-36H2,1-2H3,(H,30,31) |
| InChIKey | PNFXTNWJNUNSNU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|