C21H24N2O2 — CID 142073560
4-(6-ethyl-7-methoxyquinolin-4-yl)oxy-N,2,3-trimethylaniline (PubChem CID 142073560) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(6-ethyl-7-methoxyquinolin-4-yl)oxy-N,2,3-trimethylaniline.
| Compound Name | 4-(6-ethyl-7-methoxyquinolin-4-yl)oxy-N,2,3-trimethylaniline |
|---|---|
| PubChem CID | 142073560 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-(6-ethyl-7-methoxyquinolin-4-yl)oxy-N,2,3-trimethylaniline |
| SMILES | CCc1cc2c(Oc3ccc(NC)c(C)c3C)ccnc2cc1OC |
| InChI | InChI=1S/C21H24N2O2/c1-6-15-11-16-18(12-21(15)24-5)23-10-9-20(16)25-19-8-7-17(22-4)13(2)14(19)3/h7-12,22H,6H2,1-5H3 |
| InChIKey | WBPVDXPOECKTQC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |