C24H25N5O4S2 — CID 23118586
1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 23118586) has the molecular formula C24H25N5O4S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 23118586 |
| Molecular Formula | C24H25N5O4S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCSc1nnc(NC(=O)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)c(C)c2C)s1 |
| InChI | InChI=1S/C24H25N5O4S2/c1-6-34-24-29-28-23(35-24)27-22(30)26-16-7-8-18(14(3)13(16)2)33-19-9-10-25-17-12-21(32-5)20(31-4)11-15(17)19/h7-12H,6H2,1-5H3,(H2,26,27,28,30) |
| InChIKey | BZHMADYBSIHYFY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|