C27H25ClN2O4S — CID 58738986
S-(4-chloro-2-methylphenyl) N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamothioate (PubChem CID 58738986) has the molecular formula C27H25ClN2O4S and a molecular weight of 509.03 g/mol. Its IUPAC name is S-(4-chloro-2-methylphenyl) N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamothioate.
| Compound Name | S-(4-chloro-2-methylphenyl) N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamothioate |
|---|---|
| PubChem CID | 58738986 |
| Molecular Formula | C27H25ClN2O4S |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | S-(4-chloro-2-methylphenyl) N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamothioate |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Sc4ccc(Cl)cc4C)c(C)c3C)c2cc1OC |
| InChI | InChI=1S/C27H25ClN2O4S/c1-15-12-18(28)6-9-26(15)35-27(31)30-20-7-8-22(17(3)16(20)2)34-23-10-11-29-21-14-25(33-5)24(32-4)13-19(21)23/h6-14H,1-5H3,(H,30,31) |
| InChIKey | UDZNABDJVXFJPO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|