C43H45N7O7S2 — CID 159698158
4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylaniline;1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 159698158) has the molecular formula C43H45N7O7S2 and a molecular weight of 836.01 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylaniline;1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylaniline;1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 159698158 |
| Molecular Formula | C43H45N7O7S2 |
| Molecular Weight | 836.01 g/mol |
| Exact Mass | 835.28 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylaniline;1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]-3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCSc1nnc(NC(=O)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)c(C)c2C)s1.COc1cc2nccc(Oc3ccc(N)c(C)c3C)c2cc1OC |
| InChI | InChI=1S/C24H25N5O4S2.C19H20N2O3/c1-6-34-24-29-28-23(35-24)27-22(30)26-16-7-8-18(14(3)13(16)2)33-19-9-10-25-17-12-21(32-5)20(31-4)11-15(17)19;1-11-12(2)16(6-5-14(11)20)24-17-7-8-21-15-10-19(23-4)18(22-3)9-13(15)17/h7-12H,6H2,1-5H3,(H2,26,27,28,30);5-10H,20H2,1-4H3 |
| InChIKey | MXGXDRKKSLDBEY-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 174.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.01 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|