C29H30N2O5S — CID 58738988
2-(4-methylphenyl)sulfanylethyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamate (PubChem CID 58738988) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanylethyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamate.
| Compound Name | 2-(4-methylphenyl)sulfanylethyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 58738988 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-(4-methylphenyl)sulfanylethyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,3-dimethylphenyl]carbamate |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)OCCSc4ccc(C)cc4)c(C)c3C)c2cc1OC |
| InChI | InChI=1S/C29H30N2O5S/c1-18-6-8-21(9-7-18)37-15-14-35-29(32)31-23-10-11-25(20(3)19(23)2)36-26-12-13-30-24-17-28(34-5)27(33-4)16-22(24)26/h6-13,16-17H,14-15H2,1-5H3,(H,31,32) |
| InChIKey | SHLZMEZTYCRTDM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|