C24H27FN2O5 — CID 54167934
2-fluoro-3-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-6-methylphenol (PubChem CID 54167934) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-fluoro-3-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-6-methylphenol.
| Compound Name | 2-fluoro-3-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-6-methylphenol |
|---|---|
| PubChem CID | 54167934 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-fluoro-3-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxy-6-methylphenol |
| SMILES | COc1cc2c(Oc3ccc(C)c(O)c3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C24H27FN2O5/c1-16-4-5-20(23(25)24(16)28)32-19-6-7-26-18-15-22(21(29-2)14-17(18)19)31-11-3-8-27-9-12-30-13-10-27/h4-7,14-15,28H,3,8-13H2,1-2H3 |
| InChIKey | OSYNVNIPDCTNGY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|