C25H27FN4O4 — CID 123411897
4-[3-[4-[(4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]-6-methoxyquinolin-7-yl]oxypropyl]morpholine (PubChem CID 123411897) has the molecular formula C25H27FN4O4 and a molecular weight of 466.51 g/mol. Its IUPAC name is 4-[3-[4-[(4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]-6-methoxyquinolin-7-yl]oxypropyl]morpholine.
| Compound Name | 4-[3-[4-[(4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]-6-methoxyquinolin-7-yl]oxypropyl]morpholine |
|---|---|
| PubChem CID | 123411897 |
| Molecular Formula | C25H27FN4O4 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-[3-[4-[(4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]-6-methoxyquinolin-7-yl]oxypropyl]morpholine |
| SMILES | COc1cc2c(Oc3cnc4[nH]c(C)cc4c3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C25H27FN4O4/c1-16-12-18-24(26)23(15-28-25(18)29-16)34-20-4-5-27-19-14-22(21(31-2)13-17(19)20)33-9-3-6-30-7-10-32-11-8-30/h4-5,12-15H,3,6-11H2,1-2H3,(H,28,29) |
| InChIKey | AAWLFJDTNBNZHE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|