C16H13F2N3O4 — CID 118527987
N-[5-(6,7-dimethoxyquinazolin-4-yl)oxy-2,4-difluorophenyl]hydroxylamine (PubChem CID 118527987) has the molecular formula C16H13F2N3O4 and a molecular weight of 349.29 g/mol. Its IUPAC name is N-[5-(6,7-dimethoxyquinazolin-4-yl)oxy-2,4-difluorophenyl]hydroxylamine.
| Compound Name | N-[5-(6,7-dimethoxyquinazolin-4-yl)oxy-2,4-difluorophenyl]hydroxylamine |
|---|---|
| PubChem CID | 118527987 |
| Molecular Formula | C16H13F2N3O4 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[5-(6,7-dimethoxyquinazolin-4-yl)oxy-2,4-difluorophenyl]hydroxylamine |
| SMILES | COc1cc2ncnc(Oc3cc(NO)c(F)cc3F)c2cc1OC |
| InChI | InChI=1S/C16H13F2N3O4/c1-23-14-3-8-11(5-15(14)24-2)19-7-20-16(8)25-13-6-12(21-22)9(17)4-10(13)18/h3-7,21-22H,1-2H3 |
| InChIKey | XEWJTJCZNWOHFG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|