C13H16N3O5S- — CID 166071327
6,7-dimethoxy-4-[3-(sulfinatoamino)propoxy]quinazoline (PubChem CID 166071327) has the molecular formula C13H16N3O5S- and a molecular weight of 326.35 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[3-(sulfinatoamino)propoxy]quinazoline.
| Compound Name | 6,7-dimethoxy-4-[3-(sulfinatoamino)propoxy]quinazoline |
|---|---|
| PubChem CID | 166071327 |
| Molecular Formula | C13H16N3O5S- |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 6,7-dimethoxy-4-[3-(sulfinatoamino)propoxy]quinazoline |
| SMILES | COc1cc2ncnc(OCCCNS(=O)[O-])c2cc1OC |
| InChI | InChI=1S/C13H17N3O5S/c1-19-11-6-9-10(7-12(11)20-2)14-8-15-13(9)21-5-3-4-16-22(17)18/h6-8,16H,3-5H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | CLXXGCHVFWJOEX-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|