C16H20N2O3S — CID 157041055
6,7-dimethoxy-4-(thian-4-ylmethoxy)quinazoline (PubChem CID 157041055) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(thian-4-ylmethoxy)quinazoline.
| Compound Name | 6,7-dimethoxy-4-(thian-4-ylmethoxy)quinazoline |
|---|---|
| PubChem CID | 157041055 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 6,7-dimethoxy-4-(thian-4-ylmethoxy)quinazoline |
| SMILES | COc1cc2ncnc(OCC3CCSCC3)c2cc1OC |
| InChI | InChI=1S/C16H20N2O3S/c1-19-14-7-12-13(8-15(14)20-2)17-10-18-16(12)21-9-11-3-5-22-6-4-11/h7-8,10-11H,3-6,9H2,1-2H3 |
| InChIKey | BTXFXZMAUJTGQB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |