C19H30N3O4P — CID 157041419
2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonous acid;ethane (PubChem CID 157041419) has the molecular formula C19H30N3O4P and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonous acid;ethane.
| Compound Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonous acid;ethane |
|---|---|
| PubChem CID | 157041419 |
| Molecular Formula | C19H30N3O4P |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonous acid;ethane |
| SMILES | CC.COc1cc2ncnc(N3CCC(CCP(O)O)CC3)c2cc1OC |
| InChI | InChI=1S/C17H24N3O4P.C2H6/c1-23-15-9-13-14(10-16(15)24-2)18-11-19-17(13)20-6-3-12(4-7-20)5-8-25(21)22;1-2/h9-12,21-22H,3-8H2,1-2H3;1-2H3 |
| InChIKey | XHVNHHBGNRGVLM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|