C23H38N5O3P — CID 138468581
N-[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-(propan-2-ylamino)phosphoryl]propan-2-amine (PubChem CID 138468581) has the molecular formula C23H38N5O3P and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-(propan-2-ylamino)phosphoryl]propan-2-amine.
| Compound Name | N-[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-(propan-2-ylamino)phosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 138468581 |
| Molecular Formula | C23H38N5O3P |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-(propan-2-ylamino)phosphoryl]propan-2-amine |
| SMILES | COc1cc2ncnc(N3CCC(CCP(=O)(NC(C)C)NC(C)C)CC3)c2cc1OC |
| InChI | InChI=1S/C23H38N5O3P/c1-16(2)26-32(29,27-17(3)4)12-9-18-7-10-28(11-8-18)23-19-13-21(30-5)22(31-6)14-20(19)24-15-25-23/h13-18H,7-12H2,1-6H3,(H2,26,27,29) |
| InChIKey | XYEWKEYYZAVNCP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|