C18H26N3O2P — CID 170032979
2-[1-(6,7-dimethylquinazolin-4-yl)piperidin-4-yl]ethyl-methylphosphinic acid (PubChem CID 170032979) has the molecular formula C18H26N3O2P and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[1-(6,7-dimethylquinazolin-4-yl)piperidin-4-yl]ethyl-methylphosphinic acid.
| Compound Name | 2-[1-(6,7-dimethylquinazolin-4-yl)piperidin-4-yl]ethyl-methylphosphinic acid |
|---|---|
| PubChem CID | 170032979 |
| Molecular Formula | C18H26N3O2P |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[1-(6,7-dimethylquinazolin-4-yl)piperidin-4-yl]ethyl-methylphosphinic acid |
| SMILES | Cc1cc2ncnc(N3CCC(CCP(C)(=O)O)CC3)c2cc1C |
| InChI | InChI=1S/C18H26N3O2P/c1-13-10-16-17(11-14(13)2)19-12-20-18(16)21-7-4-15(5-8-21)6-9-24(3,22)23/h10-12,15H,4-9H2,1-3H3,(H,22,23) |
| InChIKey | WLTYCOKJKVSMOS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|