C23H28N3O5P — CID 175033782
2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethoxy-phenylphosphinic acid (PubChem CID 175033782) has the molecular formula C23H28N3O5P and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethoxy-phenylphosphinic acid.
| Compound Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethoxy-phenylphosphinic acid |
|---|---|
| PubChem CID | 175033782 |
| Molecular Formula | C23H28N3O5P |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethoxy-phenylphosphinic acid |
| SMILES | COc1cc2ncnc(N3CCC(CCOP(=O)(O)c4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C23H28N3O5P/c1-29-21-14-19-20(15-22(21)30-2)24-16-25-23(19)26-11-8-17(9-12-26)10-13-31-32(27,28)18-6-4-3-5-7-18/h3-7,14-17H,8-13H2,1-2H3,(H,27,28) |
| InChIKey | ZEIILBVYCOUNLS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|