C30H43N4O5P — CID 142542801
ethane;propan-2-yl 2-[[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-phenoxyphosphanyl]amino]acetate (PubChem CID 142542801) has the molecular formula C30H43N4O5P and a molecular weight of 570.67 g/mol. Its IUPAC name is ethane;propan-2-yl 2-[[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-phenoxyphosphanyl]amino]acetate.
| Compound Name | ethane;propan-2-yl 2-[[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-phenoxyphosphanyl]amino]acetate |
|---|---|
| PubChem CID | 142542801 |
| Molecular Formula | C30H43N4O5P |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | ethane;propan-2-yl 2-[[2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-phenoxyphosphanyl]amino]acetate |
| SMILES | CC.COc1cc2ncnc(N3CCC(CCP(NCC(=O)OC(C)C)Oc4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C28H37N4O5P.C2H6/c1-20(2)36-27(33)18-31-38(37-22-8-6-5-7-9-22)15-12-21-10-13-32(14-11-21)28-23-16-25(34-3)26(35-4)17-24(23)29-19-30-28;1-2/h5-9,16-17,19-21,31H,10-15,18H2,1-4H3;1-2H3 |
| InChIKey | DXVHXQXDTUXMGB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|