C23H40N3O4P — CID 154673008
2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-dimethoxyphosphane;ethane (PubChem CID 154673008) has the molecular formula C23H40N3O4P and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-dimethoxyphosphane;ethane.
| Compound Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-dimethoxyphosphane;ethane |
|---|---|
| PubChem CID | 154673008 |
| Molecular Formula | C23H40N3O4P |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethyl-dimethoxyphosphane;ethane |
| SMILES | CC.CC.COc1cc2ncnc(N3CCC(CCP(OC)OC)CC3)c2cc1OC |
| InChI | InChI=1S/C19H28N3O4P.2C2H6/c1-23-17-11-15-16(12-18(17)24-2)20-13-21-19(15)22-8-5-14(6-9-22)7-10-27(25-3)26-4;2*1-2/h11-14H,5-10H2,1-4H3;2*1-2H3 |
| InChIKey | GDALDVITYTYKMB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|