C18H24F2N4O2S — CID 142539742
N-(difluoromethylsulfanyl)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanamine (PubChem CID 142539742) has the molecular formula C18H24F2N4O2S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-(difluoromethylsulfanyl)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanamine.
| Compound Name | N-(difluoromethylsulfanyl)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 142539742 |
| Molecular Formula | C18H24F2N4O2S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(difluoromethylsulfanyl)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanamine |
| SMILES | COc1cc2ncnc(N3CCC(CCNSC(F)F)CC3)c2cc1OC |
| InChI | InChI=1S/C18H24F2N4O2S/c1-25-15-9-13-14(10-16(15)26-2)21-11-22-17(13)24-7-4-12(5-8-24)3-6-23-27-18(19)20/h9-12,18,23H,3-8H2,1-2H3 |
| InChIKey | WUFHDNZNRNVNPU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|