C16H24N5O7PS — CID 155125330
[7-methoxy-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]quinazolin-6-yl] dihydrogen phosphate (PubChem CID 155125330) has the molecular formula C16H24N5O7PS and a molecular weight of 461.44 g/mol. Its IUPAC name is [7-methoxy-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]quinazolin-6-yl] dihydrogen phosphate.
| Compound Name | [7-methoxy-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]quinazolin-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155125330 |
| Molecular Formula | C16H24N5O7PS |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [7-methoxy-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]quinazolin-6-yl] dihydrogen phosphate |
| SMILES | COc1cc2ncnc(N3CCC(CCNS(N)(=O)=O)CC3)c2cc1OP(=O)(O)O |
| InChI | InChI=1S/C16H24N5O7PS/c1-27-14-9-13-12(8-15(14)28-29(22,23)24)16(19-10-18-13)21-6-3-11(4-7-21)2-5-20-30(17,25)26/h8-11,20H,2-7H2,1H3,(H2,17,25,26)(H2,22,23,24) |
| InChIKey | CMGHTDFSIDRIRL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|