C16H23N5O4S — CID 164991759
6-(methoxymethoxy)-7-methyl-4-[3-[2-(sulfamoylamino)ethyl]azetidin-1-yl]quinazoline (PubChem CID 164991759) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is 6-(methoxymethoxy)-7-methyl-4-[3-[2-(sulfamoylamino)ethyl]azetidin-1-yl]quinazoline.
| Compound Name | 6-(methoxymethoxy)-7-methyl-4-[3-[2-(sulfamoylamino)ethyl]azetidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 164991759 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 6-(methoxymethoxy)-7-methyl-4-[3-[2-(sulfamoylamino)ethyl]azetidin-1-yl]quinazoline |
| SMILES | COCOc1cc2c(N3CC(CCNS(N)(=O)=O)C3)ncnc2cc1C |
| InChI | InChI=1S/C16H23N5O4S/c1-11-5-14-13(6-15(11)25-10-24-2)16(19-9-18-14)21-7-12(8-21)3-4-20-26(17,22)23/h5-6,9,12,20H,3-4,7-8,10H2,1-2H3,(H2,17,22,23) |
| InChIKey | GYMVJNROYFGSSC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|