About 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid
3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid (PubChem CID 163274731) has the molecular formula C16H19N3O4
and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid |
| PubChem CID | 163274731 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid |
| SMILES | COc1cc2ncnc(N3CC(CCC(=O)O)C3)c2cc1OC |
| InChI | InChI=1S/C16H19N3O4/c1-22-13-5-11-12(6-14(13)23-2)17-9-18-16(11)19-7-10(8-19)3-4-15(20)21/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,21) |
| InChIKey | NZAUFKGAJOINKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid?
The IUPAC name of 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid (CID 163274731) is 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid?
The canonical SMILES for 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid is COc1cc2ncnc(N3CC(CCC(=O)O)C3)c2cc1OC.
What is the InChIKey of 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid?
The InChIKey is NZAUFKGAJOINKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-22-13-5-11-12(6-14(13)23-2)17-9-18-16(11)19-7-10(8-19)3-4-15(20)21/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,21).
What are the key properties of 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid?
3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid has a molecular weight of 317.35 g/mol, XLogP of 1.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid is sourced from PubChem (CID 163274731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).