C16H19N3O4 — CID 163274731
3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid (PubChem CID 163274731) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid.
| Compound Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 163274731 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)azetidin-3-yl]propanoic acid |
| SMILES | COc1cc2ncnc(N3CC(CCC(=O)O)C3)c2cc1OC |
| InChI | InChI=1S/C16H19N3O4/c1-22-13-5-11-12(6-14(13)23-2)17-9-18-16(11)19-7-10(8-19)3-4-15(20)21/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,21) |
| InChIKey | NZAUFKGAJOINKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |