C18H27N5O2S — CID 159739862
6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinazoline (PubChem CID 159739862) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinazoline.
| Compound Name | 6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinazoline |
|---|---|
| PubChem CID | 159739862 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinazoline |
| SMILES | Cc1cc2ncnc(N3CCCC(CCNS(N)(=O)=O)CC3)c2cc1C |
| InChI | InChI=1S/C18H27N5O2S/c1-13-10-16-17(11-14(13)2)20-12-21-18(16)23-8-3-4-15(6-9-23)5-7-22-26(19,24)25/h10-12,15,22H,3-9H2,1-2H3,(H2,19,24,25) |
| InChIKey | NCHVCUZITXNPME-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |