C20H27N5O2S — CID 157469584
3-cyano-6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinoline (PubChem CID 157469584) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 3-cyano-6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinoline.
| Compound Name | 3-cyano-6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinoline |
|---|---|
| PubChem CID | 157469584 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-cyano-6,7-dimethyl-4-[4-[2-(sulfamoylamino)ethyl]azepan-1-yl]quinoline |
| SMILES | Cc1cc2ncc(C#N)c(N3CCCC(CCNS(N)(=O)=O)CC3)c2cc1C |
| InChI | InChI=1S/C20H27N5O2S/c1-14-10-18-19(11-15(14)2)23-13-17(12-21)20(18)25-8-3-4-16(6-9-25)5-7-24-28(22,26)27/h10-11,13,16,24H,3-9H2,1-2H3,(H2,22,26,27) |
| InChIKey | BUWISNIOTSFWJL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |