C19H24N3O5P — CID 167505895
2-[1-(3-cyano-6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]ethyl dihydrogen phosphite (PubChem CID 167505895) has the molecular formula C19H24N3O5P and a molecular weight of 405.39 g/mol. Its IUPAC name is 2-[1-(3-cyano-6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]ethyl dihydrogen phosphite.
| Compound Name | 2-[1-(3-cyano-6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]ethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 167505895 |
| Molecular Formula | C19H24N3O5P |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[1-(3-cyano-6,7-dimethoxyquinolin-4-yl)piperidin-4-yl]ethyl dihydrogen phosphite |
| SMILES | COc1cc2ncc(C#N)c(N3CCC(CCOP(O)O)CC3)c2cc1OC |
| InChI | InChI=1S/C19H24N3O5P/c1-25-17-9-15-16(10-18(17)26-2)21-12-14(11-20)19(15)22-6-3-13(4-7-22)5-8-27-28(23)24/h9-10,12-13,23-24H,3-8H2,1-2H3 |
| InChIKey | BUTAJNZSMNIFPV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|