C17H17N3O4 — CID 143371135
[1-(3-cyano-6,7-dimethoxyquinolin-4-yl)pyrrolidin-3-yl] formate (PubChem CID 143371135) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is [1-(3-cyano-6,7-dimethoxyquinolin-4-yl)pyrrolidin-3-yl] formate.
| Compound Name | [1-(3-cyano-6,7-dimethoxyquinolin-4-yl)pyrrolidin-3-yl] formate |
|---|---|
| PubChem CID | 143371135 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [1-(3-cyano-6,7-dimethoxyquinolin-4-yl)pyrrolidin-3-yl] formate |
| SMILES | COc1cc2ncc(C#N)c(N3CCC(OC=O)C3)c2cc1OC |
| InChI | InChI=1S/C17H17N3O4/c1-22-15-5-13-14(6-16(15)23-2)19-8-11(7-18)17(13)20-4-3-12(9-20)24-10-21/h5-6,8,10,12H,3-4,9H2,1-2H3 |
| InChIKey | OCDJNTLXJJQIEK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|