C18H16F3N3O — CID 166814907
4-(4-formyl-3-methylpiperidin-1-yl)-7-(trifluoromethyl)quinoline-3-carbonitrile (PubChem CID 166814907) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-(4-formyl-3-methylpiperidin-1-yl)-7-(trifluoromethyl)quinoline-3-carbonitrile.
| Compound Name | 4-(4-formyl-3-methylpiperidin-1-yl)-7-(trifluoromethyl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 166814907 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-(4-formyl-3-methylpiperidin-1-yl)-7-(trifluoromethyl)quinoline-3-carbonitrile |
| SMILES | CC1CN(c2c(C#N)cnc3cc(C(F)(F)F)ccc23)CCC1C=O |
| InChI | InChI=1S/C18H16F3N3O/c1-11-9-24(5-4-12(11)10-25)17-13(7-22)8-23-16-6-14(18(19,20)21)2-3-15(16)17/h2-3,6,8,10-12H,4-5,9H2,1H3 |
| InChIKey | RLPFEQHJHHBGAX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|