C22H27N3O3 — CID 142290702
tert-butyl 1-(3-cyano-7-methoxyquinolin-4-yl)-3-methylpiperidine-4-carboxylate (PubChem CID 142290702) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl 1-(3-cyano-7-methoxyquinolin-4-yl)-3-methylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-(3-cyano-7-methoxyquinolin-4-yl)-3-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 142290702 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl 1-(3-cyano-7-methoxyquinolin-4-yl)-3-methylpiperidine-4-carboxylate |
| SMILES | COc1ccc2c(N3CCC(C(=O)OC(C)(C)C)C(C)C3)c(C#N)cnc2c1 |
| InChI | InChI=1S/C22H27N3O3/c1-14-13-25(9-8-17(14)21(26)28-22(2,3)4)20-15(11-23)12-24-19-10-16(27-5)6-7-18(19)20/h6-7,10,12,14,17H,8-9,13H2,1-5H3 |
| InChIKey | JMANUIYVPYBKMI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |