C24H24N4O2S — CID 53113699
1-(3-cyano-7-methoxyquinolin-4-yl)-N-(3-methylsulfanylphenyl)piperidine-4-carboxamide (PubChem CID 53113699) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-(3-cyano-7-methoxyquinolin-4-yl)-N-(3-methylsulfanylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-cyano-7-methoxyquinolin-4-yl)-N-(3-methylsulfanylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53113699 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-(3-cyano-7-methoxyquinolin-4-yl)-N-(3-methylsulfanylphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2c(N3CCC(C(=O)Nc4cccc(SC)c4)CC3)c(C#N)cnc2c1 |
| InChI | InChI=1S/C24H24N4O2S/c1-30-19-6-7-21-22(13-19)26-15-17(14-25)23(21)28-10-8-16(9-11-28)24(29)27-18-4-3-5-20(12-18)31-2/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,27,29) |
| InChIKey | VTRXZTHSMAEMLL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |