C25H26N4O3 — CID 53002466
1-(3-cyano-6-methoxyquinolin-4-yl)-N-[(2-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 53002466) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-(3-cyano-6-methoxyquinolin-4-yl)-N-[(2-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-cyano-6-methoxyquinolin-4-yl)-N-[(2-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53002466 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-(3-cyano-6-methoxyquinolin-4-yl)-N-[(2-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(C#N)c(N3CCC(C(=O)NCc4ccccc4OC)CC3)c2c1 |
| InChI | InChI=1S/C25H26N4O3/c1-31-20-7-8-22-21(13-20)24(19(14-26)16-27-22)29-11-9-17(10-12-29)25(30)28-15-18-5-3-4-6-23(18)32-2/h3-8,13,16-17H,9-12,15H2,1-2H3,(H,28,30) |
| InChIKey | LHZHUBPODZXCHW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |