C17H20N3O4P — CID 154672957
[1-(3-cyano-6-methoxyquinolin-4-yl)piperidin-4-yl]methyl dihydrogen phosphite (PubChem CID 154672957) has the molecular formula C17H20N3O4P and a molecular weight of 361.34 g/mol. Its IUPAC name is [1-(3-cyano-6-methoxyquinolin-4-yl)piperidin-4-yl]methyl dihydrogen phosphite.
| Compound Name | [1-(3-cyano-6-methoxyquinolin-4-yl)piperidin-4-yl]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 154672957 |
| Molecular Formula | C17H20N3O4P |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | [1-(3-cyano-6-methoxyquinolin-4-yl)piperidin-4-yl]methyl dihydrogen phosphite |
| SMILES | COc1ccc2ncc(C#N)c(N3CCC(COP(O)O)CC3)c2c1 |
| InChI | InChI=1S/C17H20N3O4P/c1-23-14-2-3-16-15(8-14)17(13(9-18)10-19-16)20-6-4-12(5-7-20)11-24-25(21)22/h2-3,8,10,12,21-22H,4-7,11H2,1H3 |
| InChIKey | HTGLNGKJCWBGAV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|