C25H24N4O4 — CID 53002484
methyl 3-[[1-(3-cyano-6-methoxyquinolin-4-yl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 53002484) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is methyl 3-[[1-(3-cyano-6-methoxyquinolin-4-yl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[1-(3-cyano-6-methoxyquinolin-4-yl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 53002484 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl 3-[[1-(3-cyano-6-methoxyquinolin-4-yl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C2CCN(c3c(C#N)cnc4ccc(OC)cc34)CC2)c1 |
| InChI | InChI=1S/C25H24N4O4/c1-32-20-6-7-22-21(13-20)23(18(14-26)15-27-22)29-10-8-16(9-11-29)24(30)28-19-5-3-4-17(12-19)25(31)33-2/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,28,30) |
| InChIKey | GEARKECJOXCOPC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |