C24H23FN4O — CID 133317144
1-(3-cyanoquinolin-4-yl)-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 133317144) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-(3-cyanoquinolin-4-yl)-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-cyanoquinolin-4-yl)-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133317144 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-(3-cyanoquinolin-4-yl)-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(c3c(C#N)cnc4ccccc34)CC2)cc1F |
| InChI | InChI=1S/C24H23FN4O/c1-16-6-7-17(12-21(16)25)14-28-24(30)18-8-10-29(11-9-18)23-19(13-26)15-27-22-5-3-2-4-20(22)23/h2-7,12,15,18H,8-11,14H2,1H3,(H,28,30) |
| InChIKey | QCEOMKQCMZEHSU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |