C17H23FN2O3 — CID 124689641
(2R)-2-[4-[(3-fluoro-4-methylphenyl)methylcarbamoyl]piperidin-1-yl]propanoic acid (PubChem CID 124689641) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is (2R)-2-[4-[(3-fluoro-4-methylphenyl)methylcarbamoyl]piperidin-1-yl]propanoic acid.
| Compound Name | (2R)-2-[4-[(3-fluoro-4-methylphenyl)methylcarbamoyl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 124689641 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2R)-2-[4-[(3-fluoro-4-methylphenyl)methylcarbamoyl]piperidin-1-yl]propanoic acid |
| SMILES | Cc1ccc(CNC(=O)C2CCN([C@H](C)C(=O)O)CC2)cc1F |
| InChI | InChI=1S/C17H23FN2O3/c1-11-3-4-13(9-15(11)18)10-19-16(21)14-5-7-20(8-6-14)12(2)17(22)23/h3-4,9,12,14H,5-8,10H2,1-2H3,(H,19,21)(H,22,23)/t12-/m1/s1 |
| InChIKey | GOUHIKWOSYEMGY-GFCCVEGCSA-N |
| XLogP | 1.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |