C20H28FN3O2 — CID 119287959
N-[(3-fluoro-4-methylphenyl)methyl]-1-(piperidine-2-carbonyl)piperidine-4-carboxamide (PubChem CID 119287959) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-1-(piperidine-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-1-(piperidine-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119287959 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-1-(piperidine-2-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(C(=O)C3CCCCN3)CC2)cc1F |
| InChI | InChI=1S/C20H28FN3O2/c1-14-5-6-15(12-17(14)21)13-23-19(25)16-7-10-24(11-8-16)20(26)18-4-2-3-9-22-18/h5-6,12,16,18,22H,2-4,7-11,13H2,1H3,(H,23,25) |
| InChIKey | JREPYRHROUTRHF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |