C17H24FN3O2 — CID 119287979
1-[(2R)-2-aminopropanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 119287979) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-[(2R)-2-aminopropanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-aminopropanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119287979 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-[(2R)-2-aminopropanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(C(=O)[C@@H](C)N)CC2)cc1F |
| InChI | InChI=1S/C17H24FN3O2/c1-11-3-4-13(9-15(11)18)10-20-16(22)14-5-7-21(8-6-14)17(23)12(2)19/h3-4,9,12,14H,5-8,10,19H2,1-2H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | KULSIKCIKXMJFN-GFCCVEGCSA-N |
| XLogP | 1.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |