C19H22N3Na2O5P — CID 163399385
disodium;6,7-dimethoxy-4-[4-(phosphonatomethyl)azepan-1-yl]quinoline-3-carbonitrile (PubChem CID 163399385) has the molecular formula C19H22N3Na2O5P and a molecular weight of 449.36 g/mol. Its IUPAC name is disodium;6,7-dimethoxy-4-[4-(phosphonatomethyl)azepan-1-yl]quinoline-3-carbonitrile.
| Compound Name | disodium;6,7-dimethoxy-4-[4-(phosphonatomethyl)azepan-1-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 163399385 |
| Molecular Formula | C19H22N3Na2O5P |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | disodium;6,7-dimethoxy-4-[4-(phosphonatomethyl)azepan-1-yl]quinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(N3CCCC(CP(=O)([O-])[O-])CC3)c2cc1OC.[Na+].[Na+] |
| InChI | InChI=1S/C19H24N3O5P.2Na/c1-26-17-8-15-16(9-18(17)27-2)21-11-14(10-20)19(15)22-6-3-4-13(5-7-22)12-28(23,24)25;;/h8-9,11,13H,3-7,12H2,1-2H3,(H2,23,24,25);;/q;2*+1/p-2 |
| InChIKey | JXYLFIMZQPYPIA-UHFFFAOYSA-L |
| XLogP | -4.35 |
| TPSA | 121.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|