C28H29N5O4 — CID 156824023
4-[4-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,4-diazepan-1-yl]-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 156824023) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 4-[4-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,4-diazepan-1-yl]-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-[4-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,4-diazepan-1-yl]-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 156824023 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 4-[4-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,4-diazepan-1-yl]-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(N3CCCN(CCCN4C(=O)c5ccccc5C4=O)CC3)c2cc1OC |
| InChI | InChI=1S/C28H29N5O4/c1-36-24-15-22-23(16-25(24)37-2)30-18-19(17-29)26(22)32-11-5-9-31(13-14-32)10-6-12-33-27(34)20-7-3-4-8-21(20)28(33)35/h3-4,7-8,15-16,18H,5-6,9-14H2,1-2H3 |
| InChIKey | MZGRCWLLKZUCMM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|