C22H24FN3O3 — CID 10692180
2-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 10692180) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10692180 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | COc1cc(F)ccc1N1CCN(CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H24FN3O3/c1-29-20-15-16(23)7-8-19(20)25-13-11-24(12-14-25)9-4-10-26-21(27)17-5-2-3-6-18(17)22(26)28/h2-3,5-8,15H,4,9-14H2,1H3 |
| InChIKey | CYAPKGISOUOAGP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|