C20H28FN3O3 — CID 11440314
1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 11440314) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11440314 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(F)cc1N1CCN(CCCN2C(=O)C(C)C(C)C2=O)CC1 |
| InChI | InChI=1S/C20H28FN3O3/c1-14-15(2)20(26)24(19(14)25)8-4-7-22-9-11-23(12-10-22)17-13-16(21)5-6-18(17)27-3/h5-6,13-15H,4,7-12H2,1-3H3 |
| InChIKey | GSVFNEDJYBLUBU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|