C24H36FN3O3 — CID 69433853
3,4-diethyl-1-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione (PubChem CID 69433853) has the molecular formula C24H36FN3O3 and a molecular weight of 433.57 g/mol. Its IUPAC name is 3,4-diethyl-1-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 3,4-diethyl-1-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 69433853 |
| Molecular Formula | C24H36FN3O3 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 3,4-diethyl-1-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]pyrrolidine-2,5-dione |
| SMILES | CCC1C(=O)N(CCCN2CCN(c3cc(F)ccc3OC(C)C)CC2)C(=O)C1CC |
| InChI | InChI=1S/C24H36FN3O3/c1-5-19-20(6-2)24(30)28(23(19)29)11-7-10-26-12-14-27(15-13-26)21-16-18(25)8-9-22(21)31-17(3)4/h8-9,16-17,19-20H,5-7,10-15H2,1-4H3 |
| InChIKey | FKYKWUQZGNEXFS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|