C24H36F2N3O8P — CID 69408563
5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;phosphoric acid (PubChem CID 69408563) has the molecular formula C24H36F2N3O8P and a molecular weight of 563.54 g/mol. Its IUPAC name is 5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;phosphoric acid.
| Compound Name | 5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;phosphoric acid |
|---|---|
| PubChem CID | 69408563 |
| Molecular Formula | C24H36F2N3O8P |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;phosphoric acid |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CCCN2C(=O)C3CC(O)C(F)CC3C2=O)CC1.O=P(O)(O)O |
| InChI | InChI=1S/C24H33F2N3O4.H3O4P/c1-15(2)33-22-5-4-16(25)12-20(22)28-10-8-27(9-11-28)6-3-7-29-23(31)17-13-19(26)21(30)14-18(17)24(29)32;1-5(2,3)4/h4-5,12,15,17-19,21,30H,3,6-11,13-14H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | KTIPLWSFLUTXMU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|