C28H40FN3O8 — CID 15985805
butanedioic acid;5-fluoro-6-hydroxy-2-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 15985805) has the molecular formula C28H40FN3O8 and a molecular weight of 565.64 g/mol. Its IUPAC name is butanedioic acid;5-fluoro-6-hydroxy-2-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | butanedioic acid;5-fluoro-6-hydroxy-2-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15985805 |
| Molecular Formula | C28H40FN3O8 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | butanedioic acid;5-fluoro-6-hydroxy-2-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC(C)Oc1ccccc1N1CCN(CCCN2C(=O)C3CC(O)C(F)CC3C2=O)CC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C24H34FN3O4.C4H6O4/c1-16(2)32-22-7-4-3-6-20(22)27-12-10-26(11-13-27)8-5-9-28-23(30)17-14-19(25)21(29)15-18(17)24(28)31;5-3(6)1-2-4(7)8/h3-4,6-7,16-19,21,29H,5,8-15H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | UJFDUOFHNKHBNJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|