C28H40FN3O10 — CID 15985274
butanedioic acid;2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 15985274) has the molecular formula C28H40FN3O10 and a molecular weight of 597.64 g/mol. Its IUPAC name is butanedioic acid;2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | butanedioic acid;2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15985274 |
| Molecular Formula | C28H40FN3O10 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | butanedioic acid;2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CC(O)CN2C(=O)C3CC(O)C(O)CC3C2=O)CC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C24H34FN3O6.C4H6O4/c1-14(2)34-22-4-3-15(25)9-19(22)27-7-5-26(6-8-27)12-16(29)13-28-23(32)17-10-20(30)21(31)11-18(17)24(28)33;5-3(6)1-2-4(7)8/h3-4,9,14,16-18,20-21,29-31H,5-8,10-13H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | JJELDNNRWAGQJP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 188.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|