C30H40FN3O9 — CID 69408070
but-2-enedioic acid;2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 69408070) has the molecular formula C30H40FN3O9 and a molecular weight of 605.66 g/mol. Its IUPAC name is but-2-enedioic acid;2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | but-2-enedioic acid;2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 69408070 |
| Molecular Formula | C30H40FN3O9 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | but-2-enedioic acid;2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C(O)C=CC(=O)O.O=C1C2CC(O)C(O)CC2C(=O)N1CCCN1CCN(c2cc(F)ccc2OC2CCCC2)CC1 |
| InChI | InChI=1S/C26H36FN3O5.C4H4O4/c27-17-6-7-24(35-18-4-1-2-5-18)21(14-17)29-12-10-28(11-13-29)8-3-9-30-25(33)19-15-22(31)23(32)16-20(19)26(30)34;5-3(6)1-2-4(7)8/h6-7,14,18-20,22-23,31-32H,1-5,8-13,15-16H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GNCKZPBGLSIKLF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|