C26H36FN3O4 — CID 91190502
2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-6-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one (PubChem CID 91190502) has the molecular formula C26H36FN3O4 and a molecular weight of 473.59 g/mol. Its IUPAC name is 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-6-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one.
| Compound Name | 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-6-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one |
|---|---|
| PubChem CID | 91190502 |
| Molecular Formula | C26H36FN3O4 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-6-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-isoindol-5-one |
| SMILES | O=C(CN1CCN(c2cc(F)ccc2OC2CCCC2)CC1)CN1CC2CC(=O)C(O)CC2C1 |
| InChI | InChI=1S/C26H36FN3O4/c27-20-5-6-26(34-22-3-1-2-4-22)23(13-20)30-9-7-28(8-10-30)16-21(31)17-29-14-18-11-24(32)25(33)12-19(18)15-29/h5-6,13,18-19,22,24,32H,1-4,7-12,14-17H2 |
| InChIKey | VDYAMYFTIRCBOG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |