C26H32FN3O4 — CID 91251750
1-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-3-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)propan-2-one (PubChem CID 91251750) has the molecular formula C26H32FN3O4 and a molecular weight of 469.56 g/mol. Its IUPAC name is 1-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-3-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)propan-2-one.
| Compound Name | 1-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-3-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 91251750 |
| Molecular Formula | C26H32FN3O4 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 1-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-3-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)propan-2-one |
| SMILES | O=C(CN1CCN(c2cc(F)ccc2OC2CCCC2)CC1)Cn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C26H32FN3O4/c27-18-9-10-24(34-20-5-1-2-6-20)23(15-18)29-13-11-28(12-14-29)16-19(31)17-30-25(32)21-7-3-4-8-22(21)26(30)33/h3-4,9-10,15,20,32-33H,1-2,5-8,11-14,16-17H2 |
| InChIKey | GRLGMSHYDHPSHB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|