C26H37FN3O9P — CID 91091640
[2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 91091640) has the molecular formula C26H37FN3O9P and a molecular weight of 585.57 g/mol. Its IUPAC name is [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91091640 |
| Molecular Formula | C26H37FN3O9P |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1Cc2c(c(O)n(CC(O)CN3CCN(c4cc(F)ccc4OC4CCCC4)CC3)c2O)CC1O |
| InChI | InChI=1S/C26H37FN3O9P/c27-16-5-6-23(38-18-3-1-2-4-18)21(11-16)29-9-7-28(8-10-29)14-17(31)15-30-25(33)19-12-22(32)24(39-40(35,36)37)13-20(19)26(30)34/h5-6,11,17-18,22,24,31-34H,1-4,7-10,12-15H2,(H2,35,36,37) |
| InChIKey | FSAQTFHWEICCIB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|