C24H34FN3O4 — CID 91398766
2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol (PubChem CID 91398766) has the molecular formula C24H34FN3O4 and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol.
| Compound Name | 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 91398766 |
| Molecular Formula | C24H34FN3O4 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,5,6,7-tetrahydroisoindole-1,3,5-triol |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CCCn2c(O)c3c(c2O)CC(O)CC3)CC1 |
| InChI | InChI=1S/C24H34FN3O4/c1-16(2)32-22-7-4-17(25)14-21(22)27-12-10-26(11-13-27)8-3-9-28-23(30)19-6-5-18(29)15-20(19)24(28)31/h4,7,14,16,18,29-31H,3,5-6,8-13,15H2,1-2H3 |
| InChIKey | IPEQLLVJFIMGBO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |