C28H37F2N3O8 — CID 69407712
but-2-enedioic acid;5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 69407712) has the molecular formula C28H37F2N3O8 and a molecular weight of 581.61 g/mol. Its IUPAC name is but-2-enedioic acid;5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | but-2-enedioic acid;5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 69407712 |
| Molecular Formula | C28H37F2N3O8 |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | but-2-enedioic acid;5-fluoro-2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CCCN2C(=O)C3CC(O)C(F)CC3C2=O)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H33F2N3O4.C4H4O4/c1-15(2)33-22-5-4-16(25)12-20(22)28-10-8-27(9-11-28)6-3-7-29-23(31)17-13-19(26)21(30)14-18(17)24(29)32;5-3(6)1-2-4(7)8/h4-5,12,15,17-19,21,30H,3,6-11,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DOYTWSSZECHLPV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|